C27H32F4N6O2Si — CID 171630222
2-[[11-(difluoromethyl)-8-(2,6-difluorophenyl)-5-methyl-13-morpholin-4-yl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630222) has the molecular formula C27H32F4N6O2Si and a molecular weight of 576.67 g/mol. Its IUPAC name is 2-[[11-(difluoromethyl)-8-(2,6-difluorophenyl)-5-methyl-13-morpholin-4-yl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[11-(difluoromethyl)-8-(2,6-difluorophenyl)-5-methyl-13-morpholin-4-yl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630222 |
| Molecular Formula | C27H32F4N6O2Si |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2-[[11-(difluoromethyl)-8-(2,6-difluorophenyl)-5-methyl-13-morpholin-4-yl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1NC(c1c(F)cccc1F)=Nc1c-2cc(N2CCOCC2)nc1C(F)F |
| InChI | InChI=1S/C27H32F4N6O2Si/c1-16-22-25(37(35-16)15-39-12-13-40(2,3)4)17-14-20(36-8-10-38-11-9-36)32-24(26(30)31)23(17)34-27(33-22)21-18(28)6-5-7-19(21)29/h5-7,14,26H,8-13,15H2,1-4H3,(H,33,34) |
| InChIKey | MNSPQLGBNKXXFS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|