C28H38ClF2N5O2Si2 — CID 171630223
tert-butyl-[[13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methoxy]-dimethylsilane (PubChem CID 171630223) has the molecular formula C28H38ClF2N5O2Si2 and a molecular weight of 606.27 g/mol. Its IUPAC name is tert-butyl-[[13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 171630223 |
| Molecular Formula | C28H38ClF2N5O2Si2 |
| Molecular Weight | 606.27 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | tert-butyl-[[13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1cnc(Cl)cc1-2 |
| InChI | InChI=1S/C28H38ClF2N5O2Si2/c1-28(2,3)40(7,8)38-16-22-25-26(36(35-22)17-37-12-13-39(4,5)6)18-14-23(29)32-15-21(18)33-27(34-25)24-19(30)10-9-11-20(24)31/h9-11,14-15H,12-13,16-17H2,1-8H3,(H,33,34) |
| InChIKey | SFWGNYIRZGNJAK-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.27 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|