C24H28ClF2N5O2Si — CID 171630225
2-[13-chloro-8-(2,6-difluorophenyl)-5-methyl-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-11-yl]ethanol (PubChem CID 171630225) has the molecular formula C24H28ClF2N5O2Si and a molecular weight of 520.06 g/mol. Its IUPAC name is 2-[13-chloro-8-(2,6-difluorophenyl)-5-methyl-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-11-yl]ethanol.
| Compound Name | 2-[13-chloro-8-(2,6-difluorophenyl)-5-methyl-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-11-yl]ethanol |
|---|---|
| PubChem CID | 171630225 |
| Molecular Formula | C24H28ClF2N5O2Si |
| Molecular Weight | 520.06 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-[13-chloro-8-(2,6-difluorophenyl)-5-methyl-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-11-yl]ethanol |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1NC(c1c(F)cccc1F)=Nc1c-2cc(Cl)nc1CCO |
| InChI | InChI=1S/C24H28ClF2N5O2Si/c1-14-21-23(32(31-14)13-34-10-11-35(2,3)4)15-12-19(25)28-18(8-9-33)22(15)30-24(29-21)20-16(26)6-5-7-17(20)27/h5-7,12,33H,8-11,13H2,1-4H3,(H,29,30) |
| InChIKey | HBVDYNYUXFMPAA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|