C16H9ClF3N5OS — CID 171630362
[13-chloro-8-(2,6-difluorophenyl)-5-(hydroxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl] thiohypofluorite (PubChem CID 171630362) has the molecular formula C16H9ClF3N5OS and a molecular weight of 411.80 g/mol. Its IUPAC name is [13-chloro-8-(2,6-difluorophenyl)-5-(hydroxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl] thiohypofluorite.
| Compound Name | [13-chloro-8-(2,6-difluorophenyl)-5-(hydroxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 171630362 |
| Molecular Formula | C16H9ClF3N5OS |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | [13-chloro-8-(2,6-difluorophenyl)-5-(hydroxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl] thiohypofluorite |
| SMILES | OCc1nn(SF)c2c1N=C(c1c(F)cccc1F)Nc1cnc(Cl)cc1-2 |
| InChI | InChI=1S/C16H9ClF3N5OS/c17-12-4-7-10(5-21-12)22-16(13-8(18)2-1-3-9(13)19)23-14-11(6-26)24-25(27-20)15(7)14/h1-5,26H,6H2,(H,22,23) |
| InChIKey | CNFNCJJYIYESPW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|