C22H22F3N7 — CID 171630428
8-(2,6-difluorophenyl)-13-[4-(2-fluoroethyl)piperazin-1-yl]-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaene (PubChem CID 171630428) has the molecular formula C22H22F3N7 and a molecular weight of 441.46 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-13-[4-(2-fluoroethyl)piperazin-1-yl]-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaene.
| Compound Name | 8-(2,6-difluorophenyl)-13-[4-(2-fluoroethyl)piperazin-1-yl]-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 171630428 |
| Molecular Formula | C22H22F3N7 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 8-(2,6-difluorophenyl)-13-[4-(2-fluoroethyl)piperazin-1-yl]-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaene |
| SMILES | Cc1[nH]nc2c1N=C(c1c(F)cccc1F)Nc1cnc(N3CCN(CCF)CC3)cc1-2 |
| InChI | InChI=1S/C22H22F3N7/c1-13-20-21(30-29-13)14-11-18(32-9-7-31(6-5-23)8-10-32)26-12-17(14)27-22(28-20)19-15(24)3-2-4-16(19)25/h2-4,11-12H,5-10H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | RCAHNOYPYJBDBX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |