C25H26ClF2N7OSi — CID 171630440
2-[[5-chloro-8-(2,6-difluorophenyl)-13-(1-methylpyrazol-4-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630440) has the molecular formula C25H26ClF2N7OSi and a molecular weight of 542.07 g/mol. Its IUPAC name is 2-[[5-chloro-8-(2,6-difluorophenyl)-13-(1-methylpyrazol-4-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-chloro-8-(2,6-difluorophenyl)-13-(1-methylpyrazol-4-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630440 |
| Molecular Formula | C25H26ClF2N7OSi |
| Molecular Weight | 542.07 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-[[5-chloro-8-(2,6-difluorophenyl)-13-(1-methylpyrazol-4-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cn1cc(-c2cc3c(cn2)NC(c2c(F)cccc2F)=Nc2c(Cl)nn(COCC[Si](C)(C)C)c2-3)cn1 |
| InChI | InChI=1S/C25H26ClF2N7OSi/c1-34-13-15(11-30-34)19-10-16-20(12-29-19)31-25(21-17(27)6-5-7-18(21)28)32-22-23(16)35(33-24(22)26)14-36-8-9-37(2,3)4/h5-7,10-13H,8-9,14H2,1-4H3,(H,31,32) |
| InChIKey | KYZYPQLDIUSIKS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|