C30H39F2N5O3Si — CID 171630444
2-[4-[5-(2,6-difluorophenyl)-3-methyl-1-(2-trimethylsilylethoxymethyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-9-yl]morpholin-2-yl]propan-2-ol (PubChem CID 171630444) has the molecular formula C30H39F2N5O3Si and a molecular weight of 583.76 g/mol. Its IUPAC name is 2-[4-[5-(2,6-difluorophenyl)-3-methyl-1-(2-trimethylsilylethoxymethyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-9-yl]morpholin-2-yl]propan-2-ol.
| Compound Name | 2-[4-[5-(2,6-difluorophenyl)-3-methyl-1-(2-trimethylsilylethoxymethyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-9-yl]morpholin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 171630444 |
| Molecular Formula | C30H39F2N5O3Si |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 2-[4-[5-(2,6-difluorophenyl)-3-methyl-1-(2-trimethylsilylethoxymethyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-9-yl]morpholin-2-yl]propan-2-ol |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1ccc(N3CCOC(C(C)(C)O)C3)cc1-2 |
| InChI | InChI=1S/C30H39F2N5O3Si/c1-19-27-28(37(35-19)18-39-14-15-41(4,5)6)21-16-20(36-12-13-40-25(17-36)30(2,3)38)10-11-24(21)33-29(34-27)26-22(31)8-7-9-23(26)32/h7-11,16,25,38H,12-15,17-18H2,1-6H3,(H,33,34) |
| InChIKey | IFGDZUWGKAZNRL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|