C21H22FN5O2 — CID 171630545
2-ethyl-6-fluoro-4-[4-(5-methyl-3-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one (PubChem CID 171630545) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-4-[4-(5-methyl-3-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-ethyl-6-fluoro-4-[4-(5-methyl-3-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 171630545 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-ethyl-6-fluoro-4-[4-(5-methyl-3-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
| SMILES | CCn1nc(C(=O)N2CCN(c3cncc(C)c3)CC2)c2cc(F)ccc2c1=O |
| InChI | InChI=1S/C21H22FN5O2/c1-3-27-20(28)17-5-4-15(22)11-18(17)19(24-27)21(29)26-8-6-25(7-9-26)16-10-14(2)12-23-13-16/h4-5,10-13H,3,6-9H2,1-2H3 |
| InChIKey | YFRZHPBQXOGCHU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |