About 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one
7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one (PubChem CID 171630766) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one.
Molecular Properties
| Compound Name | 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one |
| PubChem CID | 171630766 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one |
| SMILES | Cn1nc(C(=O)N2CCNCC2)c2cccnc2c1=O |
| InChI | InChI=1S/C13H15N5O2/c1-17-12(19)10-9(3-2-4-15-10)11(16-17)13(20)18-7-5-14-6-8-18/h2-4,14H,5-8H2,1H3 |
| InChIKey | DUZZIDUTDYWPCT-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one?
The IUPAC name of 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one (CID 171630766) is 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one.
What is the SMILES notation for 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one?
The canonical SMILES for 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one is Cn1nc(C(=O)N2CCNCC2)c2cccnc2c1=O.
What is the InChIKey of 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one?
The InChIKey is DUZZIDUTDYWPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-17-12(19)10-9(3-2-4-15-10)11(16-17)13(20)18-7-5-14-6-8-18/h2-4,14H,5-8H2,1H3.
What are the key properties of 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one?
7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one has a molecular weight of 273.30 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5-(piperazine-1-carbonyl)pyrido[2,3-d]pyridazin-8-one is sourced from PubChem (CID 171630766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).