About 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen
1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen (PubChem CID 171631907) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen |
| PubChem CID | 171631907 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen |
| SMILES | CNCc1c(C)cccc1C.[H][H] |
| InChI | InChI=1S/C10H15N.H2/c1-8-5-4-6-9(2)10(8)7-11-3;/h4-6,11H,7H2,1-3H3;1H |
| InChIKey | BDIAPSJQNISTNV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The IUPAC name of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen (CID 171631907) is 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen.
What is the SMILES notation for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The canonical SMILES for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen is CNCc1c(C)cccc1C.[H][H].
What is the InChIKey of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The InChIKey is BDIAPSJQNISTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.H2/c1-8-5-4-6-9(2)10(8)7-11-3;/h4-6,11H,7H2,1-3H3;1H.
What are the key properties of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen has a molecular weight of 151.25 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen is sourced from PubChem (CID 171631907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).