1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen

C10H17N — CID 171631907

IUPAC1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen
SMILESCNCc1c(C)cccc1C.[H][H]
InChIInChI=1S/C10H15N.H2/c1-8-5-4-6-9(2)10(8)7-11-3;/h4-6,11H,7H2,1-3H3;1H
InChIKeyBDIAPSJQNISTNV-UHFFFAOYSA-N
MW151.25 g/mol
LogP2.27
Rot. Bonds2

About 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen

1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen (PubChem CID 171631907) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen.

Molecular Properties

Compound Name1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen
PubChem CID171631907
Molecular FormulaC10H17N
Molecular Weight151.25 g/mol
Exact Mass151.14
IUPAC Name1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen
SMILESCNCc1c(C)cccc1C.[H][H]
InChIInChI=1S/C10H15N.H2/c1-8-5-4-6-9(2)10(8)7-11-3;/h4-6,11H,7H2,1-3H3;1H
InChIKeyBDIAPSJQNISTNV-UHFFFAOYSA-N
XLogP2.27
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.25
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The IUPAC name of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen (CID 171631907) is 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen.
What is the SMILES notation for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The canonical SMILES for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen is CNCc1c(C)cccc1C.[H][H].
What is the InChIKey of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
The InChIKey is BDIAPSJQNISTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.H2/c1-8-5-4-6-9(2)10(8)7-11-3;/h4-6,11H,7H2,1-3H3;1H.
What are the key properties of 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen?
1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen has a molecular weight of 151.25 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)-N-methylmethanamine;molecular hydrogen is sourced from PubChem (CID 171631907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).