About N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane
N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane (PubChem CID 171632848) has the molecular formula C15H29F2NO2
and a molecular weight of 293.40 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane |
| PubChem CID | 171632848 |
| Molecular Formula | C15H29F2NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane |
| SMILES | CC.CCOCC(C)(C)C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2NO2.C2H6/c1-4-18-9-12(2,3)11(17)16-10-5-7-13(14,15)8-6-10;1-2/h10H,4-9H2,1-3H3,(H,16,17);1-2H3 |
| InChIKey | CFSUVZHEWAYBIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane?
The IUPAC name of N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane (CID 171632848) is N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane is CC.CCOCC(C)(C)C(=O)NC1CCC(F)(F)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane?
The InChIKey is CFSUVZHEWAYBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO2.C2H6/c1-4-18-9-12(2,3)11(17)16-10-5-7-13(14,15)8-6-10;1-2/h10H,4-9H2,1-3H3,(H,16,17);1-2H3.
What are the key properties of N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane?
N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane has a molecular weight of 293.40 g/mol, XLogP of 3.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-3-ethoxy-2,2-dimethylpropanamide;ethane is sourced from PubChem (CID 171632848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).