About N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide
N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide (PubChem CID 171633100) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide |
| PubChem CID | 171633100 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide |
| SMILES | COCC(C)(C)C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2NO2/c1-11(2,8-17-3)10(16)15-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | IDXBJBNYFRXPRO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide?
The IUPAC name of N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide (CID 171633100) is N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide is COCC(C)(C)C(=O)NC1CCC(F)(F)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide?
The InChIKey is IDXBJBNYFRXPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO2/c1-11(2,8-17-3)10(16)15-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16).
What are the key properties of N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide?
N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide has a molecular weight of 249.30 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-3-methoxy-2,2-dimethylpropanamide is sourced from PubChem (CID 171633100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).