benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid

C20H22N2O4 — CID 171634662

IUPACbenzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid
SMILESCC(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1.O=CO
InChIInChI=1S/C19H20N2O2.CH2O2/c1-14(11-16-12-20-18-10-6-5-9-17(16)18)21-19(22)23-13-15-7-3-2-4-8-15;2-1-3/h2-10,12,14,20H,11,13H2,1H3,(H,21,22);1H,(H,2,3)
InChIKeyRFLPVURAWUJASN-UHFFFAOYSA-N
MW354.41 g/mol
LogP3.73
Rot. Bonds5

About benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid

benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid (PubChem CID 171634662) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid.

Molecular Properties

Compound Namebenzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid
PubChem CID171634662
Molecular FormulaC20H22N2O4
Molecular Weight354.41 g/mol
Exact Mass354.16
IUPAC Namebenzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid
SMILESCC(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1.O=CO
InChIInChI=1S/C19H20N2O2.CH2O2/c1-14(11-16-12-20-18-10-6-5-9-17(16)18)21-19(22)23-13-15-7-3-2-4-8-15;2-1-3/h2-10,12,14,20H,11,13H2,1H3,(H,21,22);1H,(H,2,3)
InChIKeyRFLPVURAWUJASN-UHFFFAOYSA-N
XLogP3.73
TPSA91.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.41
LogP ≤ 53.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid?
The IUPAC name of benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid (CID 171634662) is benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid.
What is the SMILES notation for benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid?
The canonical SMILES for benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid is CC(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1.O=CO.
What is the InChIKey of benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid?
The InChIKey is RFLPVURAWUJASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2.CH2O2/c1-14(11-16-12-20-18-10-6-5-9-17(16)18)21-19(22)23-13-15-7-3-2-4-8-15;2-1-3/h2-10,12,14,20H,11,13H2,1H3,(H,21,22);1H,(H,2,3).
What are the key properties of benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid?
benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid has a molecular weight of 354.41 g/mol, XLogP of 3.73, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid is sourced from PubChem (CID 171634662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).