C20H22N2O4 — CID 171634662
benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid (PubChem CID 171634662) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid.
| Compound Name | benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid |
|---|---|
| PubChem CID | 171634662 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | benzyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formic acid |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1.O=CO |
| InChI | InChI=1S/C19H20N2O2.CH2O2/c1-14(11-16-12-20-18-10-6-5-9-17(16)18)21-19(22)23-13-15-7-3-2-4-8-15;2-1-3/h2-10,12,14,20H,11,13H2,1H3,(H,21,22);1H,(H,2,3) |
| InChIKey | RFLPVURAWUJASN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|