C28H54O6Si2 — CID 171634847
methyl (E)-6-[(1R,2R,5S)-2-(2-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 171634847) has the molecular formula C28H54O6Si2 and a molecular weight of 542.91 g/mol. Its IUPAC name is methyl (E)-6-[(1R,2R,5S)-2-(2-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | methyl (E)-6-[(1R,2R,5S)-2-(2-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 171634847 |
| Molecular Formula | C28H54O6Si2 |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | methyl (E)-6-[(1R,2R,5S)-2-(2-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | COC(=O)CCC(/C=C/[C@H]1[C@@H](CCOC(C)=O)CC[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O6Si2/c1-21(29)32-20-19-22-13-17-25(34-36(11,12)28(5,6)7)24(22)16-14-23(15-18-26(30)31-8)33-35(9,10)27(2,3)4/h14,16,22-25H,13,15,17-20H2,1-12H3/b16-14+/t22-,23?,24+,25+/m1/s1 |
| InChIKey | SPAKYHKRSBERCE-WWCIAKDVSA-N |
| XLogP | 7.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|