C13H24O6S — CID 171636069
3,9-diethyl-9-methoxy-3-methylsulfanyloxy-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 171636069) has the molecular formula C13H24O6S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3,9-diethyl-9-methoxy-3-methylsulfanyloxy-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-diethyl-9-methoxy-3-methylsulfanyloxy-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 171636069 |
| Molecular Formula | C13H24O6S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3,9-diethyl-9-methoxy-3-methylsulfanyloxy-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | CCC1(OC)OCC2(CO1)COC(CC)(OSC)OC2 |
| InChI | InChI=1S/C13H24O6S/c1-5-12(14-3)15-7-11(8-16-12)9-17-13(6-2,18-10-11)19-20-4/h5-10H2,1-4H3 |
| InChIKey | OLPAVJUFDOBOOS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|