About 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide
4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide (PubChem CID 17163609) has the molecular formula C13H15Br2N3OS
and a molecular weight of 421.16 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide.
Molecular Properties
| Compound Name | 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide |
| PubChem CID | 17163609 |
| Molecular Formula | C13H15Br2N3OS |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide |
| SMILES | Br.Brc1ccc(C2=NN=C(N3CCOCC3)SC2)cc1 |
| InChI | InChI=1S/C13H14BrN3OS.BrH/c14-11-3-1-10(2-4-11)12-9-19-13(16-15-12)17-5-7-18-8-6-17;/h1-4H,5-9H2;1H |
| InChIKey | SRCXXMPKFYBIRV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide?
The IUPAC name of 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide (CID 17163609) is 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide.
What is the SMILES notation for 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide?
The canonical SMILES for 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide is Br.Brc1ccc(C2=NN=C(N3CCOCC3)SC2)cc1.
What is the InChIKey of 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide?
The InChIKey is SRCXXMPKFYBIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3OS.BrH/c14-11-3-1-10(2-4-11)12-9-19-13(16-15-12)17-5-7-18-8-6-17;/h1-4H,5-9H2;1H.
What are the key properties of 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide?
4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide has a molecular weight of 421.16 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-bromophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine;hydrobromide is sourced from PubChem (CID 17163609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).