C34H34FN13O3 — CID 171637009
(2S)-4-[5-[4-[[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-1-yl]methyl]morpholine (PubChem CID 171637009) has the molecular formula C34H34FN13O3 and a molecular weight of 691.73 g/mol. Its IUPAC name is (2S)-4-[5-[4-[[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-1-yl]methyl]morpholine.
| Compound Name | (2S)-4-[5-[4-[[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-1-yl]methyl]morpholine |
|---|---|
| PubChem CID | 171637009 |
| Molecular Formula | C34H34FN13O3 |
| Molecular Weight | 691.73 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | (2S)-4-[5-[4-[[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-1-yl]methyl]morpholine |
| SMILES | Cn1cc(-c2cnc3c(nnn3C[C@@H]3CN(c4ncc(-c5ccc(CN6CCN(c7ccc([N+](=O)[O-])cc7F)CC6)cc5)cn4)CCO3)n2)cn1 |
| InChI | InChI=1S/C34H34FN13O3/c1-43-20-26(17-39-43)30-18-36-33-32(40-30)41-42-47(33)22-28-21-46(12-13-51-28)34-37-15-25(16-38-34)24-4-2-23(3-5-24)19-44-8-10-45(11-9-44)31-7-6-27(48(49)50)14-29(31)35/h2-7,14-18,20,28H,8-13,19,21-22H2,1H3/t28-/m0/s1 |
| InChIKey | KWWFLTGMYCPWOX-NDEPHWFRSA-N |
| XLogP | 3.35 |
| TPSA | 162.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|