C34H30FN7O2 — CID 171637109
3-[1-[[3-[5-[[1-(4-amino-2-fluorophenyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (PubChem CID 171637109) has the molecular formula C34H30FN7O2 and a molecular weight of 587.66 g/mol. Its IUPAC name is 3-[1-[[3-[5-[[1-(4-amino-2-fluorophenyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[3-[5-[[1-(4-amino-2-fluorophenyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 171637109 |
| Molecular Formula | C34H30FN7O2 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 3-[1-[[3-[5-[[1-(4-amino-2-fluorophenyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(=O)n(Cc3cccc(-c4ncc(OCC5CCN(c6ccc(N)cc6F)CC5)cn4)c3)n2)c1 |
| InChI | InChI=1S/C34H30FN7O2/c35-30-17-28(37)7-9-32(30)41-13-11-23(12-14-41)22-44-29-19-38-34(39-20-29)27-6-2-4-25(16-27)21-42-33(43)10-8-31(40-42)26-5-1-3-24(15-26)18-36/h1-10,15-17,19-20,23H,11-14,21-22,37H2 |
| InChIKey | BETYJGSRWQWHFK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|