C10H13BFN — CID 171637673
CID 171637673 (PubChem CID 171637673) has the molecular formula C10H13BFN and a molecular weight of 177.03 g/mol.
| Compound Name | CID 171637673 |
|---|---|
| PubChem CID | 171637673 |
| Molecular Formula | C10H13BFN |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CNCCC)cc1F |
| InChI | InChI=1S/C10H13BFN/c1-2-5-13-7-8-3-4-9(11)10(12)6-8/h3-4,6,13H,2,5,7H2,1H3 |
| InChIKey | SJZCYAKOXIJTOM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|