C26H31N5O3 — CID 171638515
4-[3-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-propan-2-ylbutanamide (PubChem CID 171638515) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[3-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-propan-2-ylbutanamide.
| Compound Name | 4-[3-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 171638515 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 4-[3-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-propan-2-ylbutanamide |
| SMILES | Cc1noc(C)c1-c1cc(N)c2ncn(Cc3cccc(OCCCC(=O)NC(C)C)c3)c2c1 |
| InChI | InChI=1S/C26H31N5O3/c1-16(2)29-24(32)9-6-10-33-21-8-5-7-19(11-21)14-31-15-28-26-22(27)12-20(13-23(26)31)25-17(3)30-34-18(25)4/h5,7-8,11-13,15-16H,6,9-10,14,27H2,1-4H3,(H,29,32) |
| InChIKey | NGWWXGWCNKBLDC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|