C25H48N6O6 — CID 171640085
2-[4-[2-[2-[3-(butylamino)-3-oxopropoxy]ethylamino]-2-oxoethyl]-7-ethyl-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171640085) has the molecular formula C25H48N6O6 and a molecular weight of 528.70 g/mol. Its IUPAC name is 2-[4-[2-[2-[3-(butylamino)-3-oxopropoxy]ethylamino]-2-oxoethyl]-7-ethyl-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-[3-(butylamino)-3-oxopropoxy]ethylamino]-2-oxoethyl]-7-ethyl-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171640085 |
| Molecular Formula | C25H48N6O6 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | 2-[4-[2-[2-[3-(butylamino)-3-oxopropoxy]ethylamino]-2-oxoethyl]-7-ethyl-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCNC(=O)CCOCCNC(=O)CN1CCN(CC)CCN(CC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C25H48N6O6/c1-3-5-7-26-23(33)6-19-37-20-8-27-24(34)21-30-13-10-28(4-2)9-11-29(17-18-32)12-14-31(16-15-30)22-25(35)36/h18H,3-17,19-22H2,1-2H3,(H,26,33)(H,27,34)(H,35,36) |
| InChIKey | QAHLYVJQQPHPDZ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|