C23H25ClF4N4O5 — CID 171640145
5-chloro-N-[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-4-fluoro-2-(4,4,4-trifluorobutanoylamino)benzamide (PubChem CID 171640145) has the molecular formula C23H25ClF4N4O5 and a molecular weight of 548.92 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-4-fluoro-2-(4,4,4-trifluorobutanoylamino)benzamide.
| Compound Name | 5-chloro-N-[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-4-fluoro-2-(4,4,4-trifluorobutanoylamino)benzamide |
|---|---|
| PubChem CID | 171640145 |
| Molecular Formula | C23H25ClF4N4O5 |
| Molecular Weight | 548.92 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 5-chloro-N-[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-4-fluoro-2-(4,4,4-trifluorobutanoylamino)benzamide |
| SMILES | C[C@@H]1C[C@@H](C[C@H](NC(=O)c2cc(Cl)c(F)cc2NC(=O)CCC(F)(F)F)C(=O)C(=O)NC2CC2)C(=O)N1 |
| InChI | InChI=1S/C23H25ClF4N4O5/c1-10-6-11(20(35)29-10)7-17(19(34)22(37)30-12-2-3-12)32-21(36)13-8-14(24)15(25)9-16(13)31-18(33)4-5-23(26,27)28/h8-12,17H,2-7H2,1H3,(H,29,35)(H,30,37)(H,31,33)(H,32,36)/t10-,11+,17+/m1/s1 |
| InChIKey | VXOFMYUSXZTLOC-RLFDGXBXSA-N |
| XLogP | 2.62 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.92 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|