C32H38FN7O2 — CID 171640504
2'-amino-4-(4-cyanoazepan-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[5,8-dihydropyrano[4,3-d]pyrimidine-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile (PubChem CID 171640504) has the molecular formula C32H38FN7O2 and a molecular weight of 571.70 g/mol. Its IUPAC name is 2'-amino-4-(4-cyanoazepan-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[5,8-dihydropyrano[4,3-d]pyrimidine-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile.
| Compound Name | 2'-amino-4-(4-cyanoazepan-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[5,8-dihydropyrano[4,3-d]pyrimidine-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile |
|---|---|
| PubChem CID | 171640504 |
| Molecular Formula | C32H38FN7O2 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | 2'-amino-4-(4-cyanoazepan-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[5,8-dihydropyrano[4,3-d]pyrimidine-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile |
| SMILES | N#Cc1c(N)ccc2c1C1(CCC2)Cc2nc(OCC34CCCN3CC(F)C4)nc(N3CCCC(C#N)CC3)c2CO1 |
| InChI | InChI=1S/C32H38FN7O2/c33-23-14-31(9-3-12-40(31)18-23)20-41-30-37-27-15-32(10-1-5-22-6-7-26(36)24(17-35)28(22)32)42-19-25(27)29(38-30)39-11-2-4-21(16-34)8-13-39/h6-7,21,23H,1-5,8-15,18-20,36H2 |
| InChIKey | KPMRVNZSOGEJSQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|