C32H38FN7O3 — CID 171640531
[1-[(4R)-6-amino-5-cyano-2'-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-yl] cyanate (PubChem CID 171640531) has the molecular formula C32H38FN7O3 and a molecular weight of 587.70 g/mol. Its IUPAC name is [1-[(4R)-6-amino-5-cyano-2'-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-yl] cyanate.
| Compound Name | [1-[(4R)-6-amino-5-cyano-2'-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-yl] cyanate |
|---|---|
| PubChem CID | 171640531 |
| Molecular Formula | C32H38FN7O3 |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | [1-[(4R)-6-amino-5-cyano-2'-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-yl] cyanate |
| SMILES | N#COC1CCCN(c2nc(OCC34CCCN3C[C@H](F)C4)nc3c2CO[C@]2(CCCc4ccc(N)c(C#N)c42)C3)CC1 |
| InChI | InChI=1S/C32H38FN7O3/c33-22-14-31(9-3-12-40(31)17-22)19-41-30-37-27-15-32(10-1-4-21-6-7-26(36)24(16-34)28(21)32)43-18-25(27)29(38-30)39-11-2-5-23(8-13-39)42-20-35/h6-7,22-23H,1-5,8-15,17-19,36H2/t22-,23?,31?,32-/m1/s1 |
| InChIKey | RWQSAJSFDWXZJP-DOSSPLCPSA-N |
| XLogP | 4.05 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|