C29H35FN6O4 — CID 171640759
6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4'-(1,4-oxazepan-4-yl)spiro[1,3-dihydroisochromene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-5-carbonitrile (PubChem CID 171640759) has the molecular formula C29H35FN6O4 and a molecular weight of 550.64 g/mol. Its IUPAC name is 6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4'-(1,4-oxazepan-4-yl)spiro[1,3-dihydroisochromene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-5-carbonitrile.
| Compound Name | 6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4'-(1,4-oxazepan-4-yl)spiro[1,3-dihydroisochromene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-5-carbonitrile |
|---|---|
| PubChem CID | 171640759 |
| Molecular Formula | C29H35FN6O4 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4'-(1,4-oxazepan-4-yl)spiro[1,3-dihydroisochromene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-5-carbonitrile |
| SMILES | N#Cc1c(N)ccc2c1C1(COC2)Cc2nc(OCC34CCCN3CC(F)C4)nc(N3CCCOCC3)c2CO1 |
| InChI | InChI=1S/C29H35FN6O4/c30-20-11-28(5-1-7-36(28)14-20)17-39-27-33-24-12-29(18-38-15-19-3-4-23(32)21(13-31)25(19)29)40-16-22(24)26(34-27)35-6-2-9-37-10-8-35/h3-4,20H,1-2,5-12,14-18,32H2 |
| InChIKey | RFPSYMGXKPIQGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|