C29H35FN6O2 — CID 171640877
1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-3-methylazetidine-3-carbonitrile (PubChem CID 171640877) has the molecular formula C29H35FN6O2 and a molecular weight of 518.64 g/mol. Its IUPAC name is 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-3-methylazetidine-3-carbonitrile.
| Compound Name | 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-3-methylazetidine-3-carbonitrile |
|---|---|
| PubChem CID | 171640877 |
| Molecular Formula | C29H35FN6O2 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-3-methylazetidine-3-carbonitrile |
| SMILES | CC1(C#N)CN(c2nc(OCC34CCCN3CC(F)C4)nc3c2COC2(CCCc4ccc(N)cc42)C3)C1 |
| InChI | InChI=1S/C29H35FN6O2/c1-27(15-31)16-35(17-27)25-22-14-38-29(8-2-4-19-5-6-21(32)10-23(19)29)12-24(22)33-26(34-25)37-18-28-7-3-9-36(28)13-20(30)11-28/h5-6,10,20H,2-4,7-9,11-14,16-18,32H2,1H3 |
| InChIKey | BRBBMVFZWGTGQI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|