About methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate
methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate (PubChem CID 171641039) has the molecular formula C15H15BrO4
and a molecular weight of 339.19 g/mol. Its IUPAC name is methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate |
| PubChem CID | 171641039 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate |
| SMILES | COC(=O)C1COC2(CCc3ccc(Br)cc32)CC1=O |
| InChI | InChI=1S/C15H15BrO4/c1-19-14(18)11-8-20-15(7-13(11)17)5-4-9-2-3-10(16)6-12(9)15/h2-3,6,11H,4-5,7-8H2,1H3 |
| InChIKey | DMGSVCCQPXAWHY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate?
The IUPAC name of methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate (CID 171641039) is methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate.
What is the SMILES notation for methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate?
The canonical SMILES for methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate is COC(=O)C1COC2(CCc3ccc(Br)cc32)CC1=O.
What is the InChIKey of methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate?
The InChIKey is DMGSVCCQPXAWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrO4/c1-19-14(18)11-8-20-15(7-13(11)17)5-4-9-2-3-10(16)6-12(9)15/h2-3,6,11H,4-5,7-8H2,1H3.
What are the key properties of methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate?
methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate has a molecular weight of 339.19 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-4'-oxospiro[1,2-dihydroindene-3,6'-oxane]-3'-carboxylate is sourced from PubChem (CID 171641039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).