About 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane
2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane (PubChem CID 171641741) has the molecular formula C18H39N2O+
and a molecular weight of 299.52 g/mol. Its IUPAC name is 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane.
Molecular Properties
| Compound Name | 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane |
| PubChem CID | 171641741 |
| Molecular Formula | C18H39N2O+ |
| Molecular Weight | 299.52 g/mol |
| Exact Mass | 299.31 |
| IUPAC Name | 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane |
| SMILES | CC.CNCCC1CCC(OC2CC[N+](C)(C)CC2)CC1 |
| InChI | InChI=1S/C16H33N2O.C2H6/c1-17-11-8-14-4-6-15(7-5-14)19-16-9-12-18(2,3)13-10-16;1-2/h14-17H,4-13H2,1-3H3;1-2H3/q+1; |
| InChIKey | RERPYAGNJQXPRL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane?
The IUPAC name of 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane (CID 171641741) is 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane.
What is the SMILES notation for 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane?
The canonical SMILES for 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane is CC.CNCCC1CCC(OC2CC[N+](C)(C)CC2)CC1.
What is the InChIKey of 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane?
The InChIKey is RERPYAGNJQXPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N2O.C2H6/c1-17-11-8-14-4-6-15(7-5-14)19-16-9-12-18(2,3)13-10-16;1-2/h14-17H,4-13H2,1-3H3;1-2H3/q+1;.
What are the key properties of 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane?
2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane has a molecular weight of 299.52 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,1-dimethylpiperidin-1-ium-4-yl)oxycyclohexyl]-N-methylethanamine;ethane is sourced from PubChem (CID 171641741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).