About 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one
6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one (PubChem CID 171642220) has the molecular formula C14H6Cl4N2O2
and a molecular weight of 376.03 g/mol. Its IUPAC name is 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one |
| PubChem CID | 171642220 |
| Molecular Formula | C14H6Cl4N2O2 |
| Molecular Weight | 376.03 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cc(Cl)c(O)c(Cl)c2)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C14H6Cl4N2O2/c15-6-3-7-11(8(16)4-6)19-13(20-14(7)22)5-1-9(17)12(21)10(18)2-5/h1-4,21H,(H,19,20,22) |
| InChIKey | HHULGWGUMCMDHZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one?
The IUPAC name of 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one (CID 171642220) is 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one.
What is the SMILES notation for 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one?
The canonical SMILES for 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one is O=c1[nH]c(-c2cc(Cl)c(O)c(Cl)c2)nc2c(Cl)cc(Cl)cc12.
What is the InChIKey of 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one?
The InChIKey is HHULGWGUMCMDHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl4N2O2/c15-6-3-7-11(8(16)4-6)19-13(20-14(7)22)5-1-9(17)12(21)10(18)2-5/h1-4,21H,(H,19,20,22).
What are the key properties of 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one?
6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one has a molecular weight of 376.03 g/mol, XLogP of 4.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-2-(3,5-dichloro-4-hydroxyphenyl)-3H-quinazolin-4-one is sourced from PubChem (CID 171642220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).