C17H31N3O3 — CID 171642372
N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide;methanamine (PubChem CID 171642372) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide;methanamine.
| Compound Name | N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide;methanamine |
|---|---|
| PubChem CID | 171642372 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide;methanamine |
| SMILES | C/C=C\C=C/C(=C\C)NC(=O)CCCCCCC(=O)NO.CN |
| InChI | InChI=1S/C16H26N2O3.CH5N/c1-3-5-8-11-14(4-2)17-15(19)12-9-6-7-10-13-16(20)18-21;1-2/h3-5,8,11,21H,6-7,9-10,12-13H2,1-2H3,(H,17,19)(H,18,20);2H2,1H3/b5-3-,11-8-,14-4+; |
| InChIKey | ZBQZVCFNDJJIQM-VZTCBQDZSA-N |
| XLogP | 2.56 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|