C9H12N2O3S — CID 17164247
ethyl 5-acetamido-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 17164247) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is ethyl 5-acetamido-3-methyl-1,2-thiazole-4-carboxylate.
| Compound Name | ethyl 5-acetamido-3-methyl-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 17164247 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethyl 5-acetamido-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nsc1NC(C)=O |
| InChI | InChI=1S/C9H12N2O3S/c1-4-14-9(13)7-5(2)11-15-8(7)10-6(3)12/h4H2,1-3H3,(H,10,12) |
| InChIKey | OCIYVYIEXQYNFF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |