C19H36O — CID 171642518
1-[(3S,3aS,6R,9aR)-3a,6-dimethyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]ethanone;ethane;molecular hydrogen (PubChem CID 171642518) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-[(3S,3aS,6R,9aR)-3a,6-dimethyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]ethanone;ethane;molecular hydrogen.
| Compound Name | 1-[(3S,3aS,6R,9aR)-3a,6-dimethyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]ethanone;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 171642518 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 1-[(3S,3aS,6R,9aR)-3a,6-dimethyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]ethanone;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)[C@H]1CCC2[C@@H]3CC=C[C@@H](C)C3CC[C@@]21C.[H][H].[H][H] |
| InChI | InChI=1S/C17H26O.C2H6.2H2/c1-11-5-4-6-14-13(11)9-10-17(3)15(12(2)18)7-8-16(14)17;1-2;;/h4-5,11,13-16H,6-10H2,1-3H3;1-2H3;2*1H/t11-,13?,14-,15-,16?,17-;;;/m1.../s1 |
| InChIKey | PGCNJAHPRXOMMG-PDRQAZTASA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|