C25H46O2 — CID 171642652
ethane;(8S)-17-(2-hydroxypropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;methane (PubChem CID 171642652) has the molecular formula C25H46O2 and a molecular weight of 378.64 g/mol. Its IUPAC name is ethane;(8S)-17-(2-hydroxypropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;methane.
| Compound Name | ethane;(8S)-17-(2-hydroxypropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;methane |
|---|---|
| PubChem CID | 171642652 |
| Molecular Formula | C25H46O2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | ethane;(8S)-17-(2-hydroxypropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;methane |
| SMILES | C.CC.CC(O)CC1CCC2[C@@H]3CCC4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C22H36O2.C2H6.CH4/c1-14(23)12-15-5-7-19-18-6-4-16-13-17(24)8-10-21(16,2)20(18)9-11-22(15,19)3;1-2;/h14-16,18-20,23H,4-13H2,1-3H3;1-2H3;1H4/t14?,15?,16?,18-,19?,20?,21?,22?;;/m0../s1 |
| InChIKey | ZFOYVIRNPLKPQT-WDPPMXPFSA-N |
| XLogP | 6.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |