C26H41F3O2 — CID 171642749
(3R,5R,8R,9S,10S,13S,14S,17R)-17-[(Z,2S,3R)-3-hydroxyhex-4-en-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 171642749) has the molecular formula C26H41F3O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,17R)-17-[(Z,2S,3R)-3-hydroxyhex-4-en-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,17R)-17-[(Z,2S,3R)-3-hydroxyhex-4-en-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 171642749 |
| Molecular Formula | C26H41F3O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,17R)-17-[(Z,2S,3R)-3-hydroxyhex-4-en-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C\[C@@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41F3O2/c1-5-6-22(30)16(2)19-9-10-20-18-8-7-17-15-25(31,26(27,28)29)14-13-23(17,3)21(18)11-12-24(19,20)4/h5-6,16-22,30-31H,7-15H2,1-4H3/b6-5-/t16-,17+,18-,19+,20-,21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | JUJKGYDVBHVVTJ-POMILVGZSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|