C21H27ClN4O3 — CID 171644600
3-[(5-chloro-1H-indol-2-yl)methyl]-1-methyl-1-[1-(oxolane-2-carbonyl)piperidin-3-yl]urea (PubChem CID 171644600) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is 3-[(5-chloro-1H-indol-2-yl)methyl]-1-methyl-1-[1-(oxolane-2-carbonyl)piperidin-3-yl]urea.
| Compound Name | 3-[(5-chloro-1H-indol-2-yl)methyl]-1-methyl-1-[1-(oxolane-2-carbonyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 171644600 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[(5-chloro-1H-indol-2-yl)methyl]-1-methyl-1-[1-(oxolane-2-carbonyl)piperidin-3-yl]urea |
| SMILES | CN(C(=O)NCc1cc2cc(Cl)ccc2[nH]1)C1CCCN(C(=O)C2CCCO2)C1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-25(17-4-2-8-26(13-17)20(27)19-5-3-9-29-19)21(28)23-12-16-11-14-10-15(22)6-7-18(14)24-16/h6-7,10-11,17,19,24H,2-5,8-9,12-13H2,1H3,(H,23,28) |
| InChIKey | OSKQJZBMGJYYCX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |