About (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal
(2E)-3-amino-2-(methylideneamino)penta-2,4-dienal (PubChem CID 171645155) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal.
Molecular Properties
| Compound Name | (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal |
| PubChem CID | 171645155 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal |
| SMILES | C=C/C(N)=C(/C=O)N=C |
| InChI | InChI=1S/C6H8N2O/c1-3-5(7)6(4-9)8-2/h3-4H,1-2,7H2/b6-5+ |
| InChIKey | JSBLTVROWWSJGB-AATRIKPKSA-N |
| XLogP | 0.24 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal?
The IUPAC name of (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal (CID 171645155) is (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal.
What is the SMILES notation for (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal?
The canonical SMILES for (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal is C=C/C(N)=C(/C=O)N=C.
What is the InChIKey of (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal?
The InChIKey is JSBLTVROWWSJGB-AATRIKPKSA-N. The full InChI is InChI=1S/C6H8N2O/c1-3-5(7)6(4-9)8-2/h3-4H,1-2,7H2/b6-5+.
What are the key properties of (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal?
(2E)-3-amino-2-(methylideneamino)penta-2,4-dienal has a molecular weight of 124.14 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-amino-2-(methylideneamino)penta-2,4-dienal is sourced from PubChem (CID 171645155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).