C26H25ClFN5O3 — CID 171645581
4-[4-[2-[[(E)-1-amino-3-pent-4-en-2-yliminoprop-1-en-2-yl]amino]-2-oxoethyl]-2-chloro-5-fluorophenoxy]quinoline-6-carboxamide (PubChem CID 171645581) has the molecular formula C26H25ClFN5O3 and a molecular weight of 509.97 g/mol. Its IUPAC name is 4-[4-[2-[[(E)-1-amino-3-pent-4-en-2-yliminoprop-1-en-2-yl]amino]-2-oxoethyl]-2-chloro-5-fluorophenoxy]quinoline-6-carboxamide.
| Compound Name | 4-[4-[2-[[(E)-1-amino-3-pent-4-en-2-yliminoprop-1-en-2-yl]amino]-2-oxoethyl]-2-chloro-5-fluorophenoxy]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 171645581 |
| Molecular Formula | C26H25ClFN5O3 |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[4-[2-[[(E)-1-amino-3-pent-4-en-2-yliminoprop-1-en-2-yl]amino]-2-oxoethyl]-2-chloro-5-fluorophenoxy]quinoline-6-carboxamide |
| SMILES | C=CCC(C)/N=C/C(=C\N)NC(=O)Cc1cc(Cl)c(Oc2ccnc3ccc(C(N)=O)cc23)cc1F |
| InChI | InChI=1S/C26H25ClFN5O3/c1-3-4-15(2)32-14-18(13-29)33-25(34)11-17-10-20(27)24(12-21(17)28)36-23-7-8-31-22-6-5-16(26(30)35)9-19(22)23/h3,5-10,12-15H,1,4,11,29H2,2H3,(H2,30,35)(H,33,34)/b18-13+,32-14+ |
| InChIKey | KPABYLWATHZLKM-UYRJDCAPSA-N |
| XLogP | 4.41 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|