C30H37N3O4S — CID 171645719
(Z)-6-amino-5-(tert-butyliminomethyl)-1-[3-methyl-4-(6-propan-2-ylsulfonylquinolin-4-yl)oxyphenyl]hex-5-en-2-one (PubChem CID 171645719) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is (Z)-6-amino-5-(tert-butyliminomethyl)-1-[3-methyl-4-(6-propan-2-ylsulfonylquinolin-4-yl)oxyphenyl]hex-5-en-2-one.
| Compound Name | (Z)-6-amino-5-(tert-butyliminomethyl)-1-[3-methyl-4-(6-propan-2-ylsulfonylquinolin-4-yl)oxyphenyl]hex-5-en-2-one |
|---|---|
| PubChem CID | 171645719 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (Z)-6-amino-5-(tert-butyliminomethyl)-1-[3-methyl-4-(6-propan-2-ylsulfonylquinolin-4-yl)oxyphenyl]hex-5-en-2-one |
| SMILES | Cc1cc(CC(=O)CCC(=C/N)/C=N/C(C)(C)C)ccc1Oc1ccnc2ccc(S(=O)(=O)C(C)C)cc12 |
| InChI | InChI=1S/C30H37N3O4S/c1-20(2)38(35,36)25-10-11-27-26(17-25)29(13-14-32-27)37-28-12-8-22(15-21(28)3)16-24(34)9-7-23(18-31)19-33-30(4,5)6/h8,10-15,17-20H,7,9,16,31H2,1-6H3/b23-18-,33-19+ |
| InChIKey | MEPBJISXPRNEKO-IJIAFICXSA-N |
| XLogP | 6.12 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|