C25H29N5O3 — CID 171646541
3-[[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]amino]pyridazine-4-carbonitrile (PubChem CID 171646541) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-[[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]amino]pyridazine-4-carbonitrile.
| Compound Name | 3-[[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]amino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 171646541 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-[[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]amino]pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1N[C@H]1CCCN2C(=O)COc3ccccc3C3CCC(CC3)OC[C@@H]12 |
| InChI | InChI=1S/C25H29N5O3/c26-14-18-11-12-27-29-25(18)28-21-5-3-13-30-22(21)15-32-19-9-7-17(8-10-19)20-4-1-2-6-23(20)33-16-24(30)31/h1-2,4,6,11-12,17,19,21-22H,3,5,7-10,13,15-16H2,(H,28,29)/t17?,19?,21-,22-/m0/s1 |
| InChIKey | GQGJLKYRAYYZBP-SUOYUTEQSA-N |
| XLogP | 3.26 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |