About N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen
N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen (PubChem CID 171646626) has the molecular formula C11H25N3OS
and a molecular weight of 247.41 g/mol. Its IUPAC name is N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen |
| PubChem CID | 171646626 |
| Molecular Formula | C11H25N3OS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen |
| SMILES | CC.CC(C)(C)C(NC(=O)CS)C1(C)N=N1.[H][H] |
| InChI | InChI=1S/C9H17N3OS.C2H6.H2/c1-8(2,3)7(9(4)11-12-9)10-6(13)5-14;1-2;/h7,14H,5H2,1-4H3,(H,10,13);1-2H3;1H |
| InChIKey | MZLHNVHIIOUKMJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen?
The IUPAC name of N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen (CID 171646626) is N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen.
What is the SMILES notation for N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen?
The canonical SMILES for N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen is CC.CC(C)(C)C(NC(=O)CS)C1(C)N=N1.[H][H].
What is the InChIKey of N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen?
The InChIKey is MZLHNVHIIOUKMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS.C2H6.H2/c1-8(2,3)7(9(4)11-12-9)10-6(13)5-14;1-2;/h7,14H,5H2,1-4H3,(H,10,13);1-2H3;1H.
What are the key properties of N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen?
N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen has a molecular weight of 247.41 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dimethyl-1-(3-methyldiazirin-3-yl)propyl]-2-sulfanylacetamide;ethane;molecular hydrogen is sourced from PubChem (CID 171646626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).