C14H29N3O3 — CID 171646885
2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethanol;ethane (PubChem CID 171646885) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethanol;ethane.
| Compound Name | 2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethanol;ethane |
|---|---|
| PubChem CID | 171646885 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethanol;ethane |
| SMILES | CC.CC(C)(C)c1cn(CCOCCOCCO)nn1 |
| InChI | InChI=1S/C12H23N3O3.C2H6/c1-12(2,3)11-10-15(14-13-11)4-6-17-8-9-18-7-5-16;1-2/h10,16H,4-9H2,1-3H3;1-2H3 |
| InChIKey | WSZHYNJSGDKTLJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|