C15H12N4OS — CID 17164693
N-[(2-phenyl-1,3-thiazol-4-yl)methyl]pyrazine-2-carboxamide (PubChem CID 17164693) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[(2-phenyl-1,3-thiazol-4-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[(2-phenyl-1,3-thiazol-4-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 17164693 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[(2-phenyl-1,3-thiazol-4-yl)methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1csc(-c2ccccc2)n1)c1cnccn1 |
| InChI | InChI=1S/C15H12N4OS/c20-14(13-9-16-6-7-17-13)18-8-12-10-21-15(19-12)11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,18,20) |
| InChIKey | HIOUAIOYGIMOQT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |