About 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium
3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium (PubChem CID 171647274) has the molecular formula C13H23N2O5SY-
and a molecular weight of 408.31 g/mol. Its IUPAC name is 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium.
Molecular Properties
| Compound Name | 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium |
| PubChem CID | 171647274 |
| Molecular Formula | C13H23N2O5SY- |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium |
| SMILES | C#CCCOCCOCCOCCOCC([S-])C(=O)NN.[Y] |
| InChI | InChI=1S/C13H24N2O5S.Y/c1-2-3-4-17-5-6-18-7-8-19-9-10-20-11-12(21)13(16)15-14;/h1,12,21H,3-11,14H2,(H,15,16);/p-1 |
| InChIKey | CDPHSZMZIUPVTQ-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium?
The IUPAC name of 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium (CID 171647274) is 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium.
What is the SMILES notation for 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium?
The canonical SMILES for 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium is C#CCCOCCOCCOCCOCC([S-])C(=O)NN.[Y].
What is the InChIKey of 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium?
The InChIKey is CDPHSZMZIUPVTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H24N2O5S.Y/c1-2-3-4-17-5-6-18-7-8-19-9-10-20-11-12(21)13(16)15-14;/h1,12,21H,3-11,14H2,(H,15,16);/p-1.
What are the key properties of 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium?
3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium has a molecular weight of 408.31 g/mol, XLogP of -1.02, 14 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(2-but-3-ynoxyethoxy)ethoxy]ethoxy]-1-hydrazinyl-1-oxopropane-2-thiolate;yttrium is sourced from PubChem (CID 171647274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).