C29H44O2 — CID 171647945
ethene;2-hydroxy-4,6b,8a,11,14a-pentamethyl-5,6,6a,6a,7,8,9,10,11,12,12a,13,14,14b-tetradecahydropicen-3-one (PubChem CID 171647945) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is ethene;2-hydroxy-4,6b,8a,11,14a-pentamethyl-5,6,6a,6a,7,8,9,10,11,12,12a,13,14,14b-tetradecahydropicen-3-one.
| Compound Name | ethene;2-hydroxy-4,6b,8a,11,14a-pentamethyl-5,6,6a,6a,7,8,9,10,11,12,12a,13,14,14b-tetradecahydropicen-3-one |
|---|---|
| PubChem CID | 171647945 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | ethene;2-hydroxy-4,6b,8a,11,14a-pentamethyl-5,6,6a,6a,7,8,9,10,11,12,12a,13,14,14b-tetradecahydropicen-3-one |
| SMILES | C=C.CC1=C2CCC3C(C)(CCC4C5CC(C)CCC5(C)CCC43C)C2C=C(O)C1=O |
| InChI | InChI=1S/C27H40O2.C2H4/c1-16-8-10-25(3)12-13-27(5)19(21(25)14-16)9-11-26(4)20-15-22(28)24(29)17(2)18(20)6-7-23(26)27;1-2/h15-16,19-21,23,28H,6-14H2,1-5H3;1-2H2 |
| InChIKey | KCHQZIXLGJGZEB-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|