About 5-(hydroxymethyl)benzene-1,3-diol;propane
5-(hydroxymethyl)benzene-1,3-diol;propane (PubChem CID 171649400) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 5-(hydroxymethyl)benzene-1,3-diol;propane.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)benzene-1,3-diol;propane |
| PubChem CID | 171649400 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-(hydroxymethyl)benzene-1,3-diol;propane |
| SMILES | CCC.OCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C7H8O3.C3H8/c8-4-5-1-6(9)3-7(10)2-5;1-3-2/h1-3,8-10H,4H2;3H2,1-2H3 |
| InChIKey | HGBWOVCYGBVEQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(hydroxymethyl)benzene-1,3-diol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)benzene-1,3-diol;propane?
The IUPAC name of 5-(hydroxymethyl)benzene-1,3-diol;propane (CID 171649400) is 5-(hydroxymethyl)benzene-1,3-diol;propane.
What is the SMILES notation for 5-(hydroxymethyl)benzene-1,3-diol;propane?
The canonical SMILES for 5-(hydroxymethyl)benzene-1,3-diol;propane is CCC.OCc1cc(O)cc(O)c1.
What is the InChIKey of 5-(hydroxymethyl)benzene-1,3-diol;propane?
The InChIKey is HGBWOVCYGBVEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.C3H8/c8-4-5-1-6(9)3-7(10)2-5;1-3-2/h1-3,8-10H,4H2;3H2,1-2H3.
What are the key properties of 5-(hydroxymethyl)benzene-1,3-diol;propane?
5-(hydroxymethyl)benzene-1,3-diol;propane has a molecular weight of 184.23 g/mol, XLogP of 2.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)benzene-1,3-diol;propane is sourced from PubChem (CID 171649400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).