C18H19N3O — CID 171649499
2,6,7-trimethyl-3-[4-(methylamino)phenyl]quinazolin-4-one (PubChem CID 171649499) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 2,6,7-trimethyl-3-[4-(methylamino)phenyl]quinazolin-4-one.
| Compound Name | 2,6,7-trimethyl-3-[4-(methylamino)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 171649499 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2,6,7-trimethyl-3-[4-(methylamino)phenyl]quinazolin-4-one |
| SMILES | CNc1ccc(-n2c(C)nc3cc(C)c(C)cc3c2=O)cc1 |
| InChI | InChI=1S/C18H19N3O/c1-11-9-16-17(10-12(11)2)20-13(3)21(18(16)22)15-7-5-14(19-4)6-8-15/h5-10,19H,1-4H3 |
| InChIKey | WZXVOQUXZWIYFX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |