C9H3F4NO2 — CID 171649571
5,6,7,8-tetrafluoro-2-methyl-3,1-benzoxazin-4-one (PubChem CID 171649571) has the molecular formula C9H3F4NO2 and a molecular weight of 233.12 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-2-methyl-3,1-benzoxazin-4-one.
| Compound Name | 5,6,7,8-tetrafluoro-2-methyl-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 171649571 |
| Molecular Formula | C9H3F4NO2 |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 5,6,7,8-tetrafluoro-2-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1nc2c(F)c(F)c(F)c(F)c2c(=O)o1 |
| InChI | InChI=1S/C9H3F4NO2/c1-2-14-8-3(9(15)16-2)4(10)5(11)6(12)7(8)13/h1H3 |
| InChIKey | BJXHRINNMGRINM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|