About (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal
(2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal (PubChem CID 171650390) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal.
Molecular Properties
| Compound Name | (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal |
| PubChem CID | 171650390 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal |
| SMILES | CC(C)N[C@H](C=O)Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c1-6(2)11-8(5-13)3-7-4-10-9(14)12-7/h4-6,8,11H,3H2,1-2H3,(H2,10,12,14)/t8-/m0/s1 |
| InChIKey | RCLISNXJBDNGOL-QMMMGPOBSA-N |
| XLogP | -0.19 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal?
The IUPAC name of (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal (CID 171650390) is (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal.
What is the SMILES notation for (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal?
The canonical SMILES for (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal is CC(C)N[C@H](C=O)Cc1c[nH]c(=O)[nH]1.
What is the InChIKey of (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal?
The InChIKey is RCLISNXJBDNGOL-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6(2)11-8(5-13)3-7-4-10-9(14)12-7/h4-6,8,11H,3H2,1-2H3,(H2,10,12,14)/t8-/m0/s1.
What are the key properties of (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal?
(2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal has a molecular weight of 197.24 g/mol, XLogP of -0.19, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2-oxo-1,3-dihydroimidazol-4-yl)-2-(propan-2-ylamino)propanal is sourced from PubChem (CID 171650390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).