C31H36FN5O3 — CID 171650587
6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperidin-1-yl-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 171650587) has the molecular formula C31H36FN5O3 and a molecular weight of 545.66 g/mol. Its IUPAC name is 6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperidin-1-yl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperidin-1-yl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171650587 |
| Molecular Formula | C31H36FN5O3 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperidin-1-yl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CCc1c(F)ccc2cc(O)cc(N3Cc4nc(OCC56CCCN5CCC6)nc(N5CCCCC5)c4C3=O)c12 |
| InChI | InChI=1S/C31H36FN5O3/c1-2-22-23(32)9-8-20-16-21(38)17-25(26(20)22)37-18-24-27(29(37)39)28(35-12-4-3-5-13-35)34-30(33-24)40-19-31-10-6-14-36(31)15-7-11-31/h8-9,16-17,38H,2-7,10-15,18-19H2,1H3 |
| InChIKey | BCYUNPYXLMHJKP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |