C19H25FN4O4 — CID 171650964
tert-butyl 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-7H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 171650964) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is tert-butyl 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-7H-pyrrolo[3,4-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-7H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 171650964 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-oxo-7H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2nc(OC[C@@]34CCCN3C[C@H](F)C4)ncc2C1=O |
| InChI | InChI=1S/C19H25FN4O4/c1-18(2,3)28-17(26)24-10-14-13(15(24)25)8-21-16(22-14)27-11-19-5-4-6-23(19)9-12(20)7-19/h8,12H,4-7,9-11H2,1-3H3/t12-,19+/m1/s1 |
| InChIKey | ZFTXMRBHCCUHPI-BLVKFPJESA-N |
| XLogP | 2.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |